Tegaserod maleate 10mg
Tegaserod functions as a motility stimulant, achieving its desired therapeutic effects through activation of the 5-HT4 receptors of the enteric nervous system in the gastrointestinal tract. It also stimulates gastrointestinal motility and the peristaltic reflex, and allegedly reduces abdominal pain. Additionally, tegaserod is a 5-HT2B receptor antagonist.
Trivial name | Tegaserod maleate 10mg |
Catalog Number | A11743-10 |
Alternative Name(s) | N/A |
Molecular Formula | C₁₆H₂₃N₅O.C₄H₄O₄ |
CAS# | 189188-57-6 |
SMILES | CCCCCN=C(N)NN/C=C/1C=NC2=C1C=C(C=C2)OC.C(=CC(=O)O)C(=O)O |
Size | 10mg |
Supplier Page | http://www.adooq.com/tegaserod-maleate.html |