Edaravone (MCI-186) 10mM * 1mL in DMSO
Edaravone is a free radical scavenger with diverse protective effects that inhibits production of reactive oxygen species, apoptosis and the lipoxygenase system.
| Trivial name | Edaravone (MCI-186) 10mM * 1mL in DMSO |
| Catalog Number | A11725-10mM-D |
| Alternative Name(s) | 3-Methyl-1-phenyl-2-pyrazolin-5-one |
| Molecular Formula | C10H10N2O |
| CAS# | 89-25-8 |
| SMILES | CC1=NN(C(=O)C1)C2=CC=CC=C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/edaravone-mci-186.html |