Rasagiline mesylate 10mM * 1mL in DMSO
Rasagiline is an irreversible inhibitor of monoamine oxidase used as a monotherapy in early Parkinson’s disease or as an adjunct therapy in more advanced cases. It is selective for MAO type B over type A by a factor of fourteen.
| Trivial name | Rasagiline mesylate 10mM * 1mL in DMSO |
| Catalog Number | A11722-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C12H13N.CH4O3S |
| CAS# | 161735-79-1 |
| SMILES | CS(=O)(=O)O.C#CCN[C@@H]1CCC2=CC=CC=C12 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rasagiline-mesylate.html |