Orphenadrine citrate 10mM * 1mL in DMSO
Orphenadrine is known to have the following pharmacology: mACh receptor antagonist (anticholinergic); H1 receptor antagonist (antihistamine); NMDA receptor antagonist; NET blocker (norepinephrine reuptake inhibitor); Nav1.7, Nav1.8, and Nav1.9 sodium channel blocker; HERG potassium channel blocker.
| Trivial name | Orphenadrine citrate 10mM * 1mL in DMSO |
| Catalog Number | A11712-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C18H23NO.C6H8O7 |
| CAS# | 4682-36-4 |
| SMILES | CC1=CC=CC=C1C(C2=CC=CC=C2)OCCN(C)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/orphenadrine-citrate.html |
