Licofelone 50mg
Licofelone is a dual COX/LOX inhibitor, being considered as a treatment for osteoarthritis. It may reduce the gastrointestinal toxicity associated with other non-steroidal anti-inflammatory drugs, which only inhibit COX (cyclooxygenase). Licofelone is the first drug to inhibit both.
| Trivial name | Licofelone 50mg |
| Catalog Number | A11697-50 |
| Alternative Name(s) | [6-(4-chlorophenyl)-2,2-dimethyl-7-phenyl-2,3-dihydro-1H-pyrrolizin-5-yl]acetic acid |
| Molecular Formula | C23H22ClNO2 |
| CAS# | 156897-06-2 |
| SMILES | CC1(CC2=C(C(=C(N2C1)CC(=O)O)C3=CC=C(C=C3)Cl)C4=CC=CC=C4)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/licofelone.html |
