Fluocinonide(Vanos) 10mM * 1mL in DMSO
Fluocinonide is a potent glucocorticoid steroid used topically as an anti-inflammatory agent for the treatment of skin disorders.
Trivial name | Fluocinonide(Vanos) 10mM * 1mL in DMSO |
Catalog Number | A11688-10mM-D |
Alternative Name(s) | 6??,9-difluoro-11??,16??,17,21-tetrahydroxypregna-1,4-diene-3,20-dione, cyclic 16,17-acetal with acetone,21-acetate |
Molecular Formula | C26H32F2O7 |
CAS# | 356-12-7 |
SMILES | CC(=O)OCC(=O)[C@@]12[C@@H](C[C@@H]3[C@@]1(C[C@@H]([C@]4([C@H]3C[C@@H](C5=CC(=O)C=C[C@@]54C)F)F)O)C)OC(O2)(C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/fluocinonide-vanos.html |