Miglitol (Glyset) 50mg
Miglitol inhibits glycoside hydrolase enzymes called alpha-glucosidases. It is primarily used in diabetes mellitus type 2 for establishing greater glycemic control by preventing the digestion of carbohydrates (such as disaccharides, oligosaccharides, and polysaccharides) into monosaccharides which can be absorbed by the body.
Trivial name | Miglitol (Glyset) 50mg |
Catalog Number | A11678-50 |
Alternative Name(s) | (2R,3R,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl) piperidine-3,4,5-triol |
Molecular Formula | C8H17NO5 |
CAS# | 72432-03-2 |
SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1CCO)CO)O)O)O |
Size | 50mg |
Supplier Page | http://www.adooq.com/miglitol-glyset.html |