Rimantadine (Flumadine) 10mM * 1mL in DMSO
Rimantadine is an orally administered antiviral drug used to treat, and in rare cases prevent, influenzavirus A infection. Rimantadine is believed to inhibit influenza’s viral replication, possibly by preventing the uncoating of the virus’s protective shells, which are the envelope and capsid.
Trivial name | Rimantadine (Flumadine) 10mM * 1mL in DMSO |
Catalog Number | A11661-10mM-D |
Alternative Name(s) | (RS)-1-(1-adamantyl)ethanamine |
Molecular Formula | C12H21N |
CAS# | 13392-28-4 |
SMILES | CC(C12CC3CC(C1)CC(C3)C2)N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/rimantadine-flumadine.html |