Tolnaftate 10mM * 1mL in DMSO
Tolnaftate is a synthetic thiocarbamate used as an anti-fungal agent. It is believed to inhibit the squalene epoxidase, an important enzyme in the biosynthetic pathway of ergosterol (a key component of the fungal membrane) in a similar way to allylamines.
| Trivial name | Tolnaftate 10mM * 1mL in DMSO |
| Catalog Number | A11657-10mM-D |
| Alternative Name(s) | O-2-naphthyl methyl(3-methylphenyl)thiocarbamate |
| Molecular Formula | C19H17NOS |
| CAS# | 2398-96-1 |
| SMILES | CC1=CC(=CC=C1)N(C)C(=S)OC2=CC3=CC=CC=C3C=C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tolnaftate.html |