YK 4-279 10mM * 1mL in DMSO
YK 4-279 is an inhibitor of RNA Helicase A (RHA) binding to the oncogenic transciption factor EWS-FLI1.
Trivial name | YK 4-279 10mM * 1mL in DMSO |
Catalog Number | A11612-10mM-D |
Alternative Name(s) | 4,7-Dichloro-1,3-dihydro-3-hydroxy-3-[2-(4-methoxyphenyl)-2-oxoethyl]-2H-indol-2-one |
Molecular Formula | C17H13Cl2NO4 |
CAS# | 1037184-44-3 |
SMILES | COC1=CC=C(C=C1)C(=O)CC2(C3=C(C=CC(=C3NC2=O)Cl)Cl)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/yk-4-279.html |