Toceranib (PHA 291639, SU 11654) 50mg
Toceranib is a kinase inhibitor with both antitumor and antiangiogenic activity through inhibition of KIT, vascular endothelial growth factor receptor 2, and PDGFR??.
| Trivial name | Toceranib (PHA 291639, SU 11654) 50mg |
| Catalog Number | A11581-50 |
| Alternative Name(s) | 5-[(Z)-(5-Fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-2,4-dimethyl-N-[2-(1-pyrrolidinyl)ethyl]-1H-pyrrole-3-carboxamide |
| Molecular Formula | C22H25FN4O2 |
| CAS# | 356068-94-5 |
| SMILES | CC1=C(NC(=C1C(=O)NCCN2CCCC2)C)/C=C3/C4=C(C=CC(=C4)F)NC3=O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/toceranib-pha-291639-su-11654.html |
