SB-408124 10mg
SB-408124 is a selective non-peptide orexin OX1 receptor antagonist (Kb values are 21.7 and 1405 nM for human OX1 and OX2 receptors respectively). Blocks orexin-A induced grooming following oral administration in vivo.
| Trivial name | SB-408124 10mg |
| Catalog Number | A11567-10 |
| Alternative Name(s) | N-(6,8-Difluoro-2-methyl-4-quinolin?yl)-N'-[4-(dimethylamino)phenyl]urea |
| Molecular Formula | C19H18F2N4O |
| CAS# | 288150-92-5 |
| SMILES | CC1=NC2=C(C=C(C=C2C(=C1)NC(=O)NC3=CC=C(C=C3)N(C)C)F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sb-408124.html |