Sitaxsentan sodium 10mM * 1mL in DMSO
Sitaxentan sodium (TBC-11251) is a selective endothelin receptor-A antagonist with IC50 and Ki of 1.4 nM and 0.43 nM, respectively.
| Trivial name | Sitaxsentan sodium 10mM * 1mL in DMSO |
| Catalog Number | A11564-10mM-D |
| Alternative Name(s) | Sodium (4-chloro-3-methyl-1,2-oxazol-5-yl)-[2-[2-(6-methyl-1,3-benzodioxol-5-yl)acetyl]thiophen-3-yl]sulfonylazanide |
| Molecular Formula | C18H14ClN2NaO6S2 |
| CAS# | 210421-74-2 |
| SMILES | CC1=CC2=C(C=C1CC(=O)C3=C(C=CS3)S(=O)(=O)[N-]C4=C(C(=NO4)C)Cl)OCO2.[Na+] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sitaxsentan-sodium-tbc-11251.html |