Rimonabant (SR141716) 10mM * 1mL in DMSO
Rimonabant is a selective antagonist of CB1 with IC50 of 13.6 nM and EC50 of 17.3 nM in hCB1 transfected HEK 293 membrane.
Trivial name | Rimonabant (SR141716) 10mM * 1mL in DMSO |
Catalog Number | A11547-10mM-D |
Alternative Name(s) | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-(piperidin-1-yl)-1H-pyrazole-3-carboxamide |
Molecular Formula | C₂₂H₂₁Cl₃N₄O |
CAS# | 168273-06-1 |
SMILES | CC1=C(N(N=C1C(=O)NN2CCCCC2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/rimonabant-sr141716.html |