Pazopanib(GW-786034) 10mM * 1mL in DMSO
Pazopanib is a potent and selective multi-targeted receptor tyrosine kinase inhibitor of VEGFR-1, VEGFR-2, VEGFR-3, PDGFR-a/??, and c-kit that blocks tumor growth and inhibits angiogenesis.
Trivial name | Pazopanib(GW-786034) 10mM * 1mL in DMSO |
Catalog Number | A11518-10mM-D |
Alternative Name(s) | 5-[[4-[(2,3-Dimethyl-2H-indazol-6-yl)methylamino]-2-pyrimidinyl]amino]-2-methylbenzolsulfonamide |
Molecular Formula | C21H23N7O2S |
CAS# | 444731-52-6 |
SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pazopanib-gw-786034.html |