Nutlin 3b 5mg
Nutlin 3b is a p53/MDM2 antagonist or inhibitor with IC50 value of 13.6 uM, 150-fold less potent (+)-enantiomer of Nutlin-3 as in comparison with opposite (-)-enantiomer Nutlin-3a.
| Trivial name | Nutlin 3b 5mg |
| Catalog Number | A11502-5 |
| Alternative Name(s) | 4-?[[(4R,?5S)-?4,?5-?bis(4-?chlorophenyl)-?4,?5-?dihydro-?2-?[4-?methoxy-?2-?(1-?methylethoxy)phenyl]-?1H-?imidazol-?1-?yl]carbonyl]-?2-?piperazinone |
| Molecular Formula | C30H30Cl2N4O4 |
| CAS# | 675576-97-3 |
| SMILES | CC(C)OC1=C(C=CC(=C1)OC)C2=N[C@@H]([C@@H](N2C(=O)N3CCNC(=O)C3)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/nutlin-3b.html |
