Dovitinib (TKI-258) 10mM * 1mL in DMSO
Dovitinib is a small-molecule multitargeted receptor tyrosine kinase inhibitor, which inhibits Ba/F3 cells transformed to IL3 independence by ZNF198-FGFR1 or BCR-FGFR1 with IC50 values of 150 nM and 90 nM, respectively.
| Trivial name | Dovitinib (TKI-258) 10mM * 1mL in DMSO |
| Catalog Number | A11411-10mM-D |
| Alternative Name(s) | 4-Amino-5-fluoro-3-[5-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]quinolin-2(1H)-one |
| Molecular Formula | C21H21FN6O |
| CAS# | 405169-16-6 |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N/C(=C4/C(=C5C(=NC4=O)C=CC=C5F)N)/N3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dovitinib-tki-258.html |
