MK-5108 (VX-689) 10mM * 1mL in DMSO
MK-5108, also known as VX-689, is a competitive inhibitor of the ATP-binding site of aurora A kinase.
| Trivial name | MK-5108 (VX-689) 10mM * 1mL in DMSO |
| Catalog Number | A11410-10mM-D |
| Alternative Name(s) | trans-4-(3-Chloro-2-fluorophenoxy)-1-[[6-(2-thiazolylamino)-2-pyridinyl]methyl]cyclohexanecarboxylic acid |
| Molecular Formula | C22H21ClFN3O3S |
| CAS# | 1010085-13-8 |
| SMILES | C1CC(CCC1OC2=C(C(=CC=C2)Cl)F)(CC3=NC(=CC=C3)NC4=NC=CS4)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mk-5108-vx-689.html |
