Apatinib (YN968D1) 10mM * 1mL in DMSO
Apatinib (YN968D1) is a tyrosine kinase inhibitor that selectively inhibits the vascular endothelial growth factor receptor-2 (VEGFR2, also known as KDR) that inhibits VEGF-mediated endothelial cell migration and proliferation thus blocking new blood vessel formation in tumor tissue.
Trivial name | Apatinib (YN968D1) 10mM * 1mL in DMSO |
Catalog Number | A11407-10mM-D |
Alternative Name(s) | N-[4-(1-cyanocyclopentyl) phenyl-2-(4-picolyl)amino-3-Nicotinamide methanesulphonate |
Molecular Formula | C25H27N5O4S |
CAS# | 811803-05-1 |
SMILES | CS(=O)(=O)O.C1CCC(C1)(C#N)C2=CC=C(C=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/apatinib-yn968d1.html |