Astragaloside A 10mM * 1mL in DMSO
Astragaloside A is a novel regulator of HIF-1?? and angiogenesis through the PI3K/Akt pathway in HUVECs that are exposed to hypoxia.
Trivial name | Astragaloside A 10mM * 1mL in DMSO |
Catalog Number | A11405-10mM-D |
Alternative Name(s) | (3beta,6alpha,16beta,24R)-20,24-epoxy-16,25-dihydroxy-3-(beta-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl |
Molecular Formula | C41H68O14 |
CAS# | 83207-58-3 |
SMILES | C[C@]12CC[C@@]34C[C@@]35CC[C@@H](C([C@@H]5[C@H](C[C@H]4[C@@]1(C[C@@H]([C@@H]2[C@]6(CC[C@H](O6)C(C)(C)O)C)O)C)O[C@H]7C([C@H](C([C@H](O7)CO)O)O)O)(C)C)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/astragaloside-a.html |