CGI1746 10mM * 1mL in DMSO
CGI1746 is a small-molecule Btk inhibitor chemotype with a new binding mode that stabilizes an inactive nonphosphorylated enzyme conformation.
Trivial name | CGI1746 10mM * 1mL in DMSO |
Catalog Number | A11348-10mM-D |
Alternative Name(s) | N-[3-[4,5-Dihydro-4-methyl-6-[[4-(4-morpholinylcarbonyl)phenyl]amino]-5-oxo-2-pyrazinyl]-2-methylphenyl]-4-(tert-butyl)benzamide |
Molecular Formula | C34H37N5O4 |
CAS# | 910232-84-7 |
SMILES | CC1=C(C=CC=C1NC(=O)C2=CC=C(C=C2)C(C)(C)C)C3=CN(C(=O)C(=N3)NC4=CC=C(C=C4)C(=O)N5CCOCC5)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/cgi1746.html |