Adarotene 5mg
Adarotene belongs to the so-called class of atypical retinoids. The presence of the phenolic hydroxyl group on Adarotene structure allows a rapid O-glucuronidation as a major mechanism of elimination of the drug, favoring a fast excretion of its glucuronide metabolite in the urines.
| Trivial name | Adarotene 5mg |
| Catalog Number | A11298-5 |
| Alternative Name(s) | (2E)-3-(4'-Hydroxy-3'-tricyclo[3.3.1.13,7]dec-1-yl[1,1'-biphenyl]-4-yl)-2-propenoic acid |
| Molecular Formula | C25H26O3 |
| CAS# | 496868-77-0 |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=CC=C(C=C5)/C=C/C(=O)O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/adarotene.html |
