Apremilast (CC 10004) 10mM * 1mL in DMSO
Apremilast, a novel PDE4 inhibitor, inhibits spontaneous production of tumour necrosis factor-alpha from human rheumatoid synovial cells and ameliorates experimental arthritis.
| Trivial name | Apremilast (CC 10004) 10mM * 1mL in DMSO |
| Catalog Number | A11289-10mM-D |
| Alternative Name(s) | N-[2-[(1S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl]-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl] acetamide |
| Molecular Formula | C22H24N2O7S |
| CAS# | 608141-41-9 |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)C)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/apremilast-cc-10004.html |
