Cefozopran 10mg
Cefozopran is a fourth-generation cephalosporin. It would be effective against respiratory tract, urinary tract, and soft tissue infections caused by a variety of gram-positive and gram-negative bacteria in humans.
| Trivial name | Cefozopran 10mg |
| Catalog Number | A11284-10 |
| Alternative Name(s) | (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)- 2-methoxyiminoacetyl]amino]-3-(imidazo[2,3-f]pyridazin- 4-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate |
| Molecular Formula | C19H18ClN9O5S2 |
| CAS# | 113359-04-9 |
| SMILES | CO/N=C(/C1=NSC(=N1)N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CN4C=C[N+]5=C4C=CC=N5)C(=O)[O-] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cefozopran.html |
