A 803467 25mg
A 803467 is a selective blocker of NaV1.8 channels (IC50 values are 8, 2450, 6740, 7340 and 7380 nM for hNaV1.8, hNaV1.3, hNaV1.7, hNaV1.5 and hNaV1.2 channels respectively).
| Trivial name | A 803467 25mg |
| Catalog Number | A11234-25 |
| Alternative Name(s) | 5-(4-Chlorophenyl)-N-(3,5-dimethoxyphenyl)-2-furancarboxamide |
| Molecular Formula | C19H16ClNO4 |
| CAS# | 944261-79-4 |
| SMILES | COC1=CC(=CC(=C1)NC(=O)C2=CC=C(O2)C3=CC=C(C=C3)Cl)OC |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/a-803467.html |
