Exatecan mesylate 100mg
Exatecan mesylate inhibits topoisomerase I activity by stabilizing the cleavable complex between topoisomerase I and DNA and inhibiting religation of DNA breaks, thereby inhibiting DNA replication and triggering apoptotic cell death.
Trivial name | Exatecan mesylate 100mg |
Catalog Number | A11231-100 |
Alternative Name(s) | (1S,9S)-1-Amino-9-ethyl-5-fluoro-1,2,3,9,12,15-hexahydro-9-hydroxy-4-methyl-10H,13H-benzo(de)pyrano(3',4':6,7)indolizino(1,2-b)quinoline-10,13-dione mesylate |
Molecular Formula | C25H26FN3O7S |
CAS# | 171335-80-1 |
SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C5[C@H](CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)N)O |
Size | 100mg |
Supplier Page | http://www.adooq.com/exatecan-mesylate.html |