Azelnidipine 10mM * 1mL in DMSO
Azelnidipine is a calcium blocker that attenuates liver fibrosis and may increase antioxidant defence. that attenuates liver fibrosis and may increase antioxidant defence.
Trivial name | Azelnidipine 10mM * 1mL in DMSO |
Catalog Number | A11219-10mM-D |
Alternative Name(s) | O3-[1-[di(phenyl)methyl]azetidin-3-yl] O5-propan-2-yl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
Molecular Formula | C33H34N4O6 |
CAS# | 123524-52-7 |
SMILES | CC1=C(C(C(=C(N1)N)C(=O)OC2CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC(=CC=C5)[N+](=O)[O-])C(=O)OC(C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/azelnidipine.html |