Entecavir 50mg
Entecavir is a nucleoside analog (more specifically, a guanosine analogue) that inhibits reverse transcription, DNA replication and transcription in the viral replication process. Entecavir is an oral antiviral drug used in the treatment of hepatitis B infection.
| Trivial name | Entecavir 50mg |
| Catalog Number | A11216-50 |
| Alternative Name(s) | 2-amino-1,9-dihydro-9-[(1S,3R,4S)-4hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one, monohydrate |
| Molecular Formula | C12H15N5O3.H2O |
| CAS# | 209216-23-9, 142217-69-4 |
| SMILES | C=C1[C@@H]([C@H](CC1N2C=NC3=C2NC(=NC3=O)N)O)CO.O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/entecavir.html |
