BMS 599626 5mg
BMS 599626 is an orally bioavailable inhibitor of the HER1, HER2 and HER4 tyrosine kinases (IC50=22, 32 and 190 nM, respectively) with potential antineoplastic activity.
| Trivial name | BMS 599626 5mg |
| Catalog Number | A11209-5 |
| Alternative Name(s) | ,[4-[[1-[(3-Fluorophenyl)methyl]-1H-indazol-5-yl]amino]-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl]carbamic acid (3S)-3-morpholinylmethyl ester hydrochloride |
| Molecular Formula | C27H27FN8O3.HCl |
| CAS# | 873837-23-1 |
| SMILES | CC1=C2C(=NC=NN2C=C1NC(=O)OC[C@@H]3COCCN3)NC4=CC5=C(C=C4)N(N=C5)CC6=CC(=CC=C6)F.Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/bms-599626-ac480.html |
