PP121 50mg
PP121 is a dual inhibitor of receptor tyrosine kinases (RTKs) (IC50 < 0.02 ??M for Abl, Src, VEGFR-2 and PDGFR) and PI 3-K family kinases (IC50 < 0.06 ??M for p110??, DNA-PK and mTOR).
| Trivial name | PP121 50mg |
| Catalog Number | A11207-50 |
| Alternative Name(s) | 1-Cyclopentyl-3-(1H-pyrrolo[2,3-b]p yridin-5-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Formula | C17H17N7 |
| CAS# | 1092788-83-4 |
| SMILES | C1CCC(C1)N2C3=C(C(=N2)C4=CN=C5C(=C4)C=CN5)C(=NC=N3)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/pp121.html |
