BMS-806 (BMS 378806) 10mM * 1mL in DMSO
BMS-806, also known as BMS-378806 , is a type of medicine called an entry inhibitor. Entry inhibitors work by blocking HIV from entering human cells. BMS-378806 (BMS-806) is a small molecule that blocks the binding of host-cell CD4 with viral gp120 protein and therefore inhibits the first steps of HIV-1 infection.
| Trivial name | BMS-806 (BMS 378806) 10mM * 1mL in DMSO |
| Catalog Number | A11201-10mM-D |
| Alternative Name(s) | 1-[(2R)-4-Benzoyl-2-methyl-1-piperazinyl]-2-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2-ethanedione |
| Molecular Formula | C22H22N4O4 |
| CAS# | 357263-13-9 |
| SMILES | C[C@@H]1CN(CCN1C(=O)C(=O)C2=CNC3=NC=CC(=C23)OC)C(=O)C4=CC=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bms-806-bms-378806.html |
