AS-604850 10mM * 1mL in DMSO
AS-604850 inhibited MCP-1-mediated monocyte chemotaxis with an IC50 value of 21 µM and reduced RANTES-induced peritoneal neutrophil recruitment in a murine model of leukocyte chemotaxis with an ED50 value of 42.4 mg/kg.
| Trivial name | AS-604850 10mM * 1mL in DMSO |
| Catalog Number | A11197-10mM-D |
| Alternative Name(s) | 5-?€?[(2,?€?2-?€?difluoro-?€?1,?€?3-?€?benzodioxol-?€?5-?€?yl)methylene]-?€?2,?€?4-?€?thiazolidinedione |
| Molecular Formula | C11H5F2NO4S |
| CAS# | 48449-76-7 |
| SMILES | CCC1=COC2=CC(=O)C=C(C2=C1O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/as-604850.html |
