R547 25mg
R547 is a novel, selective inhibitor of cell cycle and transcriptional cyclin dependent kinases (CDKs) (Ki = 1, 3, and 1 nM for CDK1, CDK2, and CDK4, respectively) with excellent in vitro cellular potency that inhibits the growth of various human tumor cell lines.
| Trivial name | R547 25mg |
| Catalog Number | A11190-25 |
| Alternative Name(s) | [4-Amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl](2,3-difluoro-6-methoxyphenyl)methanone |
| Molecular Formula | C18H21F2N5O4S |
| CAS# | 741713-40-6 |
| SMILES | COC1=C(C(=C(C=C1)F)F)C(=O)C2=CN=C(N=C2N)NC3CCN(CC3)S(=O)(=O)C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/r547.html |
