Clinofibrate 10mM * 1mL in DMSO
Clinofibrate is a lipid clearing agent that appears to modify lipid metabolism, diminishing the steroid induced accumulation of lipids within osteocytes. It also can effectively reduce the plasma fibrinogen level.
Trivial name | Clinofibrate 10mM * 1mL in DMSO |
Catalog Number | A11184-10mM-D |
Alternative Name(s) | 2-(4-{1-[4-(1-carboxy-1-methylpropoxy)phenyl]cyclohexyl}phenoxy)-2-methylbutanoic acid |
Molecular Formula | C28H36O6 |
CAS# | 30299-08-2 |
SMILES | CCC(C(O)=O)(C)OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)OC(CC)(C)C(O)=O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/clinofibrate.html |