NSC-207895 5mg
NSC207895 is a cell-permeable benzofuroxan compound that downregulates the p53 negative regulator MDMX protein level in MCF-7, LNCaP, and A549 cells (1 to 10 µM for 16 to 24 h) by suppressesing MDMX promoter transcription activity (IC50 = 2.5 µM in HT1080 cells), leading to enhanced p53 stabilization and activation.
| Trivial name | NSC-207895 5mg |
| Catalog Number | A11179-5 |
| Alternative Name(s) | 4-(4-Methyl-1-piperazinyl)-7-nitrobenzofurazane 3-oxide |
| Molecular Formula | C11H13N5O4 |
| CAS# | 58131-57-0 |
| SMILES | CN1CCN(CC1)C2=CC=C(C3=NO[N+](=C23)[O-])[N+](=O)[O-] |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/nsc-207895-xi-006.html |
