Nepicastat HCl 10mM * 1mL in DMSO
Nepicastat hydrochloride is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine.
| Trivial name | Nepicastat HCl 10mM * 1mL in DMSO |
| Catalog Number | A11172-10mM-D |
| Alternative Name(s) | 5-(Aminomethyl)-1-[5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2(S)-yl]-2,3-dihydro-1H-imidazole-2-thione hydrochloride |
| Molecular Formula | C14H15F2N3S.HCl |
| CAS# | 170151-24-3 |
| SMILES | C1CC2=C(C=C(C=C2C[C@H]1N3C(=CNC3=S)CN)F)F.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/nepicastat-hydrochloride.html |
