PF-03814735 50mg
PF-03814735 is a novel, potent, orally bioavailable, reversible inhibitor of both Aurora1 and Aurora2 kinases. PF-03814735 produces a block in cytokinesis, resulting in inhibition of cell proliferation and the formation of polyploid multinucleated cells.
| Trivial name | PF-03814735 50mg |
| Catalog Number | A11171-50 |
| Alternative Name(s) | ,N-[2-[(1S,4R)-6-[[4-(Cyclobutylamino)-5-(trifluoromethyl)-2-pyrimidinyl]amino]-1,2,3,4-tetrahydronaphthalen-1,4-imin-9-yl]-2-oxoethyl]acetamide |
| Molecular Formula | C23H25F3N6O2 |
| CAS# | 942487-16-3 |
| SMILES | CC(=O)NCC(=O)N1[C@H]2CC[C@@H]1C3=C2C=CC(=C3)NC4=NC=C(C(=N4)NC5CCC5)C(F)(F)F |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/pf-03814735.html |