GSK1070916 10mM * 1mL in DMSO
GSK1070916 is a potent Aurora B/C kinase inhibitor with broad antitumor activity in tissue culture cells and human tumor xenograft models.
| Trivial name | GSK1070916 10mM * 1mL in DMSO |
| Catalog Number | A11168-10mM-D |
| Alternative Name(s) | N'-[4-[4-[2-[3-[(Dimethylamino)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-1-ethyl-1H-pyrazol-3-yl]phenyl]-N,N-dimethylurea |
| Molecular Formula | C30H33N7O |
| CAS# | 942918-07-2 |
| SMILES | CCN1C=C(C(=N1)C2=CC=C(C=C2)NC(=O)N(C)C)C3=C4C=C(NC4=NC=C3)C5=CC(=CC=C5)CN(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gsk1070916.html |
