PHA-767491 10mM * 1mL in DMSO
PHA-767491 is a potent, ATP-competitive dual cdc7/cdk9 inhibitor (IC50 values are 10 and 34 nM respectively) that prevents initiation of DNA replication.
| Trivial name | PHA-767491 10mM * 1mL in DMSO |
| Catalog Number | A11164-10mM-D |
| Alternative Name(s) | 1,5,6,7-Tetrahydro-2-(4-pyridinyl)- 4H-pyrrolo[3,2-c]pyridin-4-one hydrochloride |
| Molecular Formula | C12H11N3O |
| CAS# | 845714-00-3 |
| SMILES | C1CNC(=O)C2=C1NC(=C2)C3=CC=NC=C3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pha-767491.html |
