SL 0101-1 25mg
SL 0101-1 is a selective inhibitor of p90 ribosomal S6 kinase (RSK) (IC50 = 89 nM for RSK2). It also inhibits the growth of MCF-7 human breast cancer cells with no effect on the normal breast cell line.
| Trivial name | SL 0101-1 25mg |
| Catalog Number | A11160-25 |
| Alternative Name(s) | 3-[(3,4-Di-O-acetyl-6-deoxy-??-L-mann opyranosyl)oxy]-5,7-dihydro-2-(4-hydroxyphenyl)-4H -1benzopyran-4-one |
| Molecular Formula | C25H24O12 |
| CAS# | 77307-50-7 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)OC(=O)C)OC(=O)C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/sl-0101-1.html |
