CUDC-907 5mg
CUDC-907 is a single small molecule inhibitor that targets both PI3K and HDAC. CUDC-907 is more efficacious than either a single PI3K or HDAC inhibitor reference compound or a combination of the two single agents at maximally tolerated doses.
Trivial name | CUDC-907 5mg |
Catalog Number | A11153-5 |
Alternative Name(s) | N-hydroxy-2-(((2-(6-methoxypyridin-3-yl)-4-morpholinothieno[3,2-d]pyrimidin-6-yl)methyl)(methyl)amino)pyrimidine-5-carboxamide |
Molecular Formula | C₂₃H₂₄N₈O₄S |
CAS# | 1339928-25-4 |
SMILES | CN(CC1=CC2=C(S1)C(=NC(=N2)C3=CN=C(C=C3)OC)N4CCOCC4)C5=NC=C(C=N5)C(=O)NO |
Size | 5mg |
Supplier Page | http://www.adooq.com/cudc-907.html |