BX-795 25mg
BX-795 is a potent PDK1 inhibitor that blocks PDK1/Akt signaling in tumor cells and inhibits the anchorage-dependent growth of a variety of tumor cell lines in culture or induced apoptosis.
| Trivial name | BX-795 25mg |
| Catalog Number | A11148-25 |
| Alternative Name(s) | N-[3-[[5-Iodo-4-[[3-[(2-thienylcarbonyl)amino]propyl]amino]-2-pyrimidinyl]amino]phenyl]-1-pyrrolidinecarboxamide |
| Molecular Formula | C23H26IN7O2S |
| CAS# | 702675-74-9 |
| SMILES | C1CCN(C1)C(=O)NC2=CC=CC(=C2)NC3=NC=C(C(=N3)NCCCNC(=O)C4=CC=CS4)I |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/bx-795.html |