CEP-18770 10mM * 1mL in DMSO
CEP-18770 is a novel orally active proteasome inhibitor with a favorable tumor selectivity profile for the treatment of MM and other malignancies responsive to proteasome inhibition.
| Trivial name | CEP-18770 10mM * 1mL in DMSO |
| Catalog Number | A11145-10mM-D |
| Alternative Name(s) | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]-1-oxobutyl]amino]-3-methylbutyl]boronic acid |
| Molecular Formula | C21H28BN3O5 |
| CAS# | 847499-27-8 |
| SMILES | B([C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)C1=CC=CC(=N1)C2=CC=CC=C2)(O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cep-18770.html |
