S/GSK1349572 10mM * 1mL in DMSO
S/GSK1349572 is a potent next generation HIV integrase inhibitor and demonstrates a superior resistance profile substantiated with 60 integrase mutant molecular clones.
| Trivial name | S/GSK1349572 10mM * 1mL in DMSO |
| Catalog Number | A11068-10mM-D |
| Alternative Name(s) | (4R,12aS)-N-[(2,4-Difluorophenyl)methyl]-3,4,6,8,12,12a-hexahydro-7-hydroxy-4-methyl-6,8-dioxo-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide |
| Molecular Formula | C20H19F2N3O5 |
| CAS# | 1051375-16-6 |
| SMILES | C[C@@H]1CCO[C@@H]2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)NCC4=C(C=C(C=C4)F)F)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/s-gsk1349572.html |
