AMG 900 10mM * 1mL in DMSO
AMG 900 is a novel potent and highly selective pan-aurora kinase inhibitor with activity in taxane-resistant tumor cell lines.
| Trivial name | AMG 900 10mM * 1mL in DMSO |
| Catalog Number | A11066-10mM-D |
| Alternative Name(s) | N-[4-[[3-(2-Amino-4-pyrimidinyl)-2-pyridinyl]oxy]phenyl]-4-(4-methyl-2-thienyl)-1-phthalazinamine |
| Molecular Formula | C28H21N7OS |
| CAS# | 945595-80-2 |
| SMILES | CC1=CSC(=C1)C2=NN=C(C3=CC=CC=C32)NC4=CC=C(C=C4)OC5=C(C=CC=N5)C6=NC(=NC=C6)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/amg-900.html |
