AT13387 10mM * 1mL in DMSO
AT13387 is a targeted inhibitor of Hsp90,inhibiting its chaperone function and promoting the degradation of oncogenic signaling proteins involved in tumor cell proliferation and survival.
| Trivial name | AT13387 10mM * 1mL in DMSO |
| Catalog Number | A11062-10mM-D |
| Alternative Name(s) | (2,4-dihydroxy-5-isopropylphenyl)(5-((4-methylpiperazin-1-yl)methyl)isoindolin-2-yl)methanone |
| Molecular Formula | C24H31N3O3 |
| CAS# | 912999-49-6 |
| SMILES | CC(C)C1=C(C=C(C(=C1)C(=O)N2CC3=C(C2)C=C(C=C3)CN4CCN(CC4)C)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/at13387.html |