BMS-754807 10mM * 1mL in DMSO
BMS-754807 is an efficacious, orally active growth factor 1 receptor/insulin receptor family-targeted kinase inhibitor that may act in combination with a wide array of established anticancer agents.
| Trivial name | BMS-754807 10mM * 1mL in DMSO |
| Catalog Number | A11059-10mM-D |
| Alternative Name(s) | (2S)-1-[4-[(5-Cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-N-(6-fluoro-3-pyridinyl)-2-methyl-2-pyrrolidinecarboxamide |
| Molecular Formula | C23H24FN9O |
| CAS# | 1001350-96-4 |
| SMILES | C[C@]1(CCCN1C2=NN3C=CC=C3C(=N2)NC4=NNC(=C4)C5CC5)C(=O)NC6=CN=C(C=C6)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bms-754807.html |
