Flavopiridol HCl 10mM * 1mL in DMSO
Flavopiridol HCl is an inhibitor of cyclin-dependent kinases. The (-)-cis form induces apoptosis in particular tumor cells.
| Trivial name | Flavopiridol HCl 10mM * 1mL in DMSO |
| Catalog Number | A11045-10mM-D |
| Alternative Name(s) | (-)-2-(2-Chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methyl-4-piperidinyl]-4H-1-benzopyran-4-one hydrochloride |
| Molecular Formula | C21H20ClNO5.HCl |
| CAS# | 131740-09-5 |
| SMILES | CN1CC[C@@H]([C@@H](C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/flavopiridol-hcl.html |
