INCB018424 (Ruxolitinib) 10mM * 1mL in DMSO
INCB018424 is a potent and selective inhibitor of Janus-associated kinase (JAK) 1 and 2, with IC50 to be 2.7, 4.5 and 332 nM for JAK1, JAK2 and JAK3 respectively;
Trivial name | INCB018424 (Ruxolitinib) 10mM * 1mL in DMSO |
Catalog Number | A11041-10mM-D |
Alternative Name(s) | (R)-3-(4-(7H-Pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)-3-cyclopentylpropanenitrile |
Molecular Formula | C17H18N6 |
CAS# | 941678-49-5 |
SMILES | C1CCC(C1)[C@@H](CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/incb018424-ruxolitinib.html |