GSK2126458 10mM * 1mL in DMSO
GSK2126458 is a highly potent, orally bioavailable inhibitor of PI3K?? and mTOR with in vivo activity in both pharmacodynamic and tumor growth efficacy models.
| Trivial name | GSK2126458 10mM * 1mL in DMSO |
| Catalog Number | A11035-10mM-D |
| Alternative Name(s) | 2,4-Difluoro-N-{2-(methyloxy)-5-[4-(4-pyridazinyl)-6-quinolinyl]-3-pyridinyl}benzenesulfonamide |
| Molecular Formula | C25H17F2N5O3S |
| CAS# | 1086062-66-9 |
| SMILES | COC1=C(C=C(C=N1)C2=CC3=C(C=CN=C3C=C2)C4=CN=NC=C4)NS(=O)(=O)C5=C(C=C(C=C5)F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gsk2126458.html |